Isoamyl Butyrate
Title: Isoamyl Butyrate
CAS Registry Number: 106-27-4
Molecular Formula: C9H18O2
Molecular Weight: 158.24
Percent Composition: C 68.31%, H 11.47%, O 20.22%
Line Formula: CH3(CH2)2COOCH2CH2CH(CH3)2
Properties: Colorless liq; aromatic pear-like odor. d1519 0.866. bp 179°. Slightly sol in water; miscible with alcohol, ether.
Boiling point: bp 179°
Density: d1519 0.866
Use: Manuf artficial rum and fruit essences.

Others monographs:
Manganese PyrophosphateEicosapentaenoic AcidMeBmtIsoflavone
Mesquite GumChlorthenoxazin(e)StigmasterolCarprofen
BruceantinMetsulfuron-methylDimethylacetalOctocrylene
Strophanthobiosesec-Octyl BromideIsocorypalmineAnidulafungin
©2016 DrugLead US FDA&EMEA